CymitQuimica logo

CAS 269396-55-6

:

(βR)-β-Amino-3,4-dichlorobenzenebutanoic acid

Description:
(βR)-β-Amino-3,4-dichlorobenzenebutanoic acid, with the CAS number 269396-55-6, is a chemical compound characterized by its unique structural features, including a β-amino group and dichlorobenzene moiety. This compound typically exhibits properties associated with amino acids, such as the ability to form hydrogen bonds due to the presence of both amino and carboxylic acid functional groups. The dichlorobenzene substituents contribute to its hydrophobic characteristics, influencing its solubility and reactivity. The stereochemistry indicated by the (βR) designation suggests a specific spatial arrangement of atoms, which can significantly affect the compound's biological activity and interaction with other molecules. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting specific biological pathways. Its synthesis and characterization would involve standard organic chemistry techniques, and its behavior in biological systems would require further investigation to understand its potential applications and mechanisms of action.
Formula:C10H11Cl2NO2
InChI:InChI=1S/C10H11Cl2NO2/c11-8-2-1-6(4-9(8)12)3-7(13)5-10(14)15/h1-2,4,7H,3,5,13H2,(H,14,15)/t7-/m1/s1
InChI key:InChIKey=MVUQWYZNNRALPX-SSDOTTSWSA-N
SMILES:C([C@H](CC(O)=O)N)C1=CC(Cl)=C(Cl)C=C1
Synonyms:
  • (3R)-3-Amino-4-(3,4-dichlorophenyl)butanoic acid
  • (R)-3-Amino-4-(3,4-Dichlorophenyl)Butanoic Acid Hydrochloride
  • (βR)-β-Amino-3,4-dichlorobenzenebutanoic acid
  • Benzenebutanoic acid, β-amino-3,4-dichloro-, (betaR)-, hydrochloride (1:1)
  • Benzenebutanoic acid, β-amino-3,4-dichloro-, (βR)-
  • H-D-β-HoPhe(3,4-DiCl)-OH.HCl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.