CymitQuimica logo

CAS 270063-45-1

:

Boc-(S)-3-amino-4-(3-benzothienyl)-butyric acid

Description:
Boc-(S)-3-amino-4-(3-benzothienyl)-butyric acid is a chemical compound characterized by its structure, which includes a butyric acid backbone with an amino group and a benzothienyl substituent. The "Boc" (tert-butyloxycarbonyl) group serves as a protective group for the amino functionality, making it useful in peptide synthesis and other organic reactions. The compound is chiral, with the (S) configuration indicating the specific spatial arrangement of its atoms, which is crucial for its biological activity. It is typically used in pharmaceutical research and development, particularly in the synthesis of biologically active compounds. The presence of the benzothienyl moiety may impart unique properties, such as enhanced lipophilicity or specific interactions with biological targets. As with many amino acids and their derivatives, it may exhibit properties such as solubility in polar solvents and potential for forming hydrogen bonds, which are important for its reactivity and interactions in biological systems. Safety and handling precautions should be observed, as with all chemical substances.
Formula:C17H21NO4S
InChI:InChI=1/C17H21NO4S/c1-17(2,3)22-16(21)18-12(9-15(19)20)8-11-10-23-14-7-5-4-6-13(11)14/h4-7,10,12H,8-9H2,1-3H3,(H,18,21)(H,19,20)/t12-/m0/s1
InChI key:VRUFHPBCNHYEPJ-LBPRGKRZSA-N
SMILES:CC(C)(C)OC(=O)N[C@@H](CC1=CSC2=CC=CC=C21)CC(=O)O
Synonyms:
  • (3S)-4-(1-benzothiophen-3-yl)-3-[(tert-butoxycarbonyl)amino]butanoic acid
  • Boc-β-HoAla(3-benzothienyl)-OH
Found 4 products.