CAS 2706-90-3: Perfluorovaleric acid
Description:Perfluorovaleric acid, with the CAS number 2706-90-3, is a perfluorinated carboxylic acid characterized by a fully fluorinated carbon chain. It consists of a five-carbon backbone where all hydrogen atoms are replaced by fluorine atoms, resulting in a highly stable and hydrophobic compound. This unique structure imparts significant chemical resistance, making it inert to many reagents and conditions. Perfluorovaleric acid is typically a colorless liquid at room temperature and exhibits low volatility. Its properties include high thermal stability and a low surface tension, which contribute to its potential applications in various fields, including surfactants, lubricants, and as a building block in the synthesis of other fluorinated compounds. However, like other perfluorinated substances, it raises environmental and health concerns due to its persistence in the environment and potential bioaccumulation. Regulatory scrutiny is increasing regarding its use and disposal, emphasizing the need for careful handling and consideration of its ecological impact.
Formula:C5HF9O2
InChI:InChI=1S/C5HF9O2/c6-2(7,1(15)16)3(8,9)4(10,11)5(12,13)14/h(H,15,16)
InChI key:InChIKey=CXZGQIAOTKWCDB-UHFFFAOYSA-N
SMILES:O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F
- Synonyms:
- 2,2,3,3,4,4,5,5,5-Nonafluoropentanoic acid
- Nonafluoro-1-pentanoic acid
- Nonafluoropentanoic Acid
- Nonafluorovaleric acid
- Nsc 18404
- PFPeA
- Pentanoic acid, 2,2,3,3,4,4,5,5,5-nonafluoro-
- Pentanoic acid, nonafluoro-
- Perfluoropentanoic acid
- Valeric acid, nonafluoro-
- See more synonyms
