CymitQuimica logo

CAS 356-02-5

:

4,4,5,5,6,6,6-heptafluorohexanoic acid

Description:
4,4,5,5,6,6,6-Heptafluorohexanoic acid, with the CAS number 356-02-5, is a perfluorinated carboxylic acid characterized by the presence of seven fluorine atoms attached to a hexanoic acid backbone. This compound is notable for its high stability and resistance to degradation due to the strong carbon-fluorine bonds. It exhibits unique properties such as low surface tension and high hydrophobicity, making it useful in various applications, including surfactants and coatings. The presence of the carboxylic acid functional group imparts acidic characteristics, allowing it to participate in acid-base reactions. Additionally, its fluorinated nature contributes to its potential environmental persistence and bioaccumulation, raising concerns regarding its ecological impact. As a result, 4,4,5,5,6,6,6-heptafluorohexanoic acid is subject to regulatory scrutiny, particularly in relation to its use and disposal. Overall, this compound exemplifies the complex interplay between chemical stability, utility, and environmental considerations in the field of fluorinated chemicals.
Formula:C6H5F7O2
InChI:InChI=1/C6H5F7O2/c7-4(8,2-1-3(14)15)5(9,10)6(11,12)13/h1-2H2,(H,14,15)
InChI key:ISFKSWMQWIRDNC-UHFFFAOYSA-N
SMILES:C(CC(C(C(F)(F)F)(F)F)(F)F)C(=O)O
Synonyms:
  • Hexanoic acid, 4,4,5,5,6,6,6-heptafluoro-
Found 11 products.