CAS 271-44-3
:Indazole
Description:
Indazole is a heterocyclic compound characterized by a five-membered ring structure containing two nitrogen atoms at non-adjacent positions. Its molecular formula is C7H6N2, and it exhibits a planar structure that contributes to its stability and reactivity. Indazole is typically a colorless to pale yellow solid at room temperature and is soluble in organic solvents such as ethanol and dimethyl sulfoxide, but has limited solubility in water. The compound is known for its aromatic properties, which arise from the delocalization of electrons within the ring system. Indazole and its derivatives have garnered interest in medicinal chemistry due to their potential biological activities, including anti-inflammatory, antimicrobial, and anticancer properties. Additionally, indazole serves as a building block in the synthesis of various pharmaceuticals and agrochemicals. Its reactivity can be attributed to the presence of the nitrogen atoms, which can participate in various chemical reactions, making it a versatile compound in organic synthesis.
Formula:C7H6N2
InChI:InChI=1S/C7H6N2/c1-2-4-7-6(3-1)5-8-9-7/h1-5H,(H,8,9)
InChI key:InChIKey=BAXOFTOLAUCFNW-UHFFFAOYSA-N
SMILES:C1=2C(NN=C1)=CC=CC2
Synonyms:- 1,2-Diazaindene
- 1H-Benzopyrazole
- 1H-Indazole
- 2-Azaindole
- Benzopyrazole
- Indazol
- Isoindazole
- Nsc 26336
- Nsc 90357
- Indazole
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 11 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Indazole
CAS:Formula:C7H6N2Purity:>99.0%(GC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:118.141H-Indazole, 99%
CAS:1H-Indazole is used in organic synthesis, it can react with butyryl chloride and 1-butyryl-1H-indazole. It is also used in synthesis of several small molecule inhibitors as potential cancer therapeutics. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product porFormula:C7H6N2Purity:99%Color and Shape:Crystals or powder or crystalline powder, White to creamMolecular weight:118.14Indazole
CAS:Indazole, a heterocyclic compound, offers diverse biological activities.Formula:C7H6N2Purity:99.59% - 99.85%Color and Shape:White SolidMolecular weight:118.13591H-Indazole
CAS:1H-IndazoleFormula:C7H6N2Purity:98%Color and Shape:Solid-PowderMolecular weight:118.13594








