CymitQuimica logo

CAS 271-58-9

:

2,1-Benzisoxazole

Description:
2,1-Benzisoxazole is a heterocyclic compound characterized by its fused benzene and isoxazole rings. It typically appears as a white to light yellow crystalline solid and has a molecular formula of C8H7NO. This compound is known for its aromatic properties, which contribute to its stability and reactivity. 2,1-Benzisoxazole exhibits moderate solubility in organic solvents such as ethanol and acetone, but is generally less soluble in water due to its hydrophobic benzene ring. It is often utilized in medicinal chemistry and material science, serving as a building block for various pharmaceuticals and agrochemicals. The compound can participate in various chemical reactions, including electrophilic substitutions and nucleophilic additions, making it versatile in synthetic applications. Additionally, 2,1-benzisoxazole derivatives have been studied for their potential biological activities, including antimicrobial and anti-inflammatory properties. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity and reactivity.
Formula:C7H5NO
InChI:InChI=1S/C7H5NO/c1-2-4-7-6(3-1)5-9-8-7/h1-5H
InChI key:InChIKey=FZKCAHQKNJXICB-UHFFFAOYSA-N
SMILES:C=12C(=NOC1)C=CC=C2
Synonyms:
  • NSC 99331
  • Anthranil
  • Benz[a]isoxazole
  • 2,1-Benzisoxazole
Found 5 products.