CAS 271-70-5
:7H-pyrrolo[2,3-d]pyrimidine
Description:
7H-pyrrolo[2,3-d]pyrimidine is a heterocyclic organic compound characterized by a fused ring system that combines elements of pyrrole and pyrimidine. This compound features a bicyclic structure, where a pyrrole ring is fused to a pyrimidine ring, resulting in a nitrogen-rich framework. It typically exhibits a planar geometry, which can influence its electronic properties and reactivity. The presence of nitrogen atoms in the rings contributes to its potential as a ligand in coordination chemistry and its utility in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may exhibit various physical properties, such as solubility in polar solvents, and can participate in diverse chemical reactions, including electrophilic substitutions and nucleophilic attacks. Its derivatives are of interest in research due to their biological activities, including potential anti-cancer and anti-inflammatory effects. Overall, 7H-pyrrolo[2,3-d]pyrimidine serves as a valuable scaffold in organic synthesis and drug discovery.
Formula:C6H5N3
InChI:InChI=1/C6H5N3/c1-2-8-6-5(1)3-7-4-9-6/h1-4H,(H,7,8,9)
SMILES:c1cnc2c1cnc[nH]2
Synonyms:- 3H-pyrrolo[2,3-d]pyrimidine
- Pyrrolo(2,3-d)pyrimidine
- 1H-Pyrrolo[2,3-d]pyrimidine
- Deazapurine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
7-Deazapurine
CAS:Formula:C6H5N3Purity:>98.0%(GC)(T)Color and Shape:White to Orange to Green powder to crystalMolecular weight:119.137H-pyrrolo[2,3-d]pyrimidine
CAS:Formula:C6H5N3Purity:97%Color and Shape:SolidMolecular weight:119.1240Ref: IN-DA0034EB
1g24.00€5g54.00€10g79.00€1kgTo inquire25g127.00€250gTo inquire500gTo inquire100mg20.00€250mg20.00€7H-Pyrrolo[2,3-d]pyrimidine
CAS:7H-Pyrrolo[2,3-d]pyrimidineFormula:C6H5N3Purity:98%Color and Shape: off-white to light yellow solidMolecular weight:119.12g/mol7H-pyrrolo[2,3-d]pyrimidine
CAS:Formula:C6H5N3Purity:97%Color and Shape:SolidMolecular weight:119.1277H-Pyrrolo[2,3d]pyrimidine
CAS:<p>7H-Pyrrolo[2,3d]pyrimidine is a pyrimidine compound that has been shown to have potent antitumor activity. It inhibits the enzyme acyl-coenzyme A carboxylase (ACC) and blocks the production of malonyl-CoA, an intermediate in the metabolism of fatty acids. Malonyl-CoA is an allosteric activator of ACC, which is an important enzyme for regulating fatty acid synthesis. 7H-Pyrrolo[2,3d]pyrimidine also inhibits the expression of the gene encoding cb2 receptor, which is involved in inflammatory processes. The compound binds to a hydroxyl group on ACC to inhibit its activity. 7H-Pyrrolo[2,3d]pyrimidine has been shown to be effective against miapaca-2 cells and other cancer cell lines at concentrations as low as 1 nM. This compound also has a</p>Formula:C6H5N3Purity:Min. 95%Molecular weight:119.12 g/mol





