CAS 271-73-8
:1H-pyrazolo[3,4-b]pyridine
Description:
1H-pyrazolo[3,4-b]pyridine is a heterocyclic organic compound characterized by a fused ring system that includes both pyrazole and pyridine moieties. This compound typically exhibits a pale yellow to brownish color and is known for its aromatic properties, which contribute to its stability and reactivity. It has a molecular formula that reflects its complex structure, and it is often utilized in medicinal chemistry due to its potential biological activities, including anti-inflammatory and anticancer properties. The presence of nitrogen atoms in the ring structure enhances its ability to participate in various chemical reactions, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, 1H-pyrazolo[3,4-b]pyridine can engage in hydrogen bonding and π-π stacking interactions, which are significant in biological systems and material science applications. Its solubility varies depending on the solvent, and it is typically handled with care due to potential toxicity. Overall, this compound is of interest in both research and industrial applications due to its unique structural features and functional properties.
Formula:C6H5N3
InChI:InChI=1/C6H5N3/c1-2-5-4-8-9-6(5)7-3-1/h1-4H,(H,7,8,9)
SMILES:c1cc2c[nH]nc2nc1
Synonyms:- 2H-pyrazolo[3,4-b]pyridine
- Pyrazolo(3,4-B)Pyridine
- 1H-pyrazolo(3,4-b)pyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Pyrazolo[3,4-b]pyridine
CAS:Formula:C6H5N3Purity:>98.0%(T)(HPLC)Color and Shape:White to Yellow powder to crystalMolecular weight:119.131H-Pyrazolo[3,4-b]pyridine, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H5N3Purity:97%Molecular weight:119.131H-PYRAZOLO[3,4-B]PYRIDINE
CAS:Formula:C6H5N3Purity:97%Color and Shape:SolidMolecular weight:119.12401H-Pyrazolo[3,4-b]pyridine
CAS:1H-Pyrazolo[3,4-b]pyridineFormula:C6H5N3Purity:98%Color and Shape:SolidMolecular weight:119.1247-Azaindazole
CAS:Controlled ProductApplications A pyrazole derivative as kinase inhibitors.
References Jones, G., et al.: J. Mol. Biol., 267, 727 (1997), Misra, R., et al.: Bioorg. Med. Chem. Lett., 13, 1133 (2003),Formula:C6H5N3Color and Shape:NeatMolecular weight:119.12






