CymitQuimica logo

CAS 27151-65-1

:

Monomethyl β-methylglutarate

Description:
Monomethyl β-methylglutarate, with the CAS number 27151-65-1, is an ester derived from β-methylglutaric acid and methanol. This compound is characterized by its molecular structure, which includes a methyl group attached to the β-position of the glutarate backbone, contributing to its unique properties. It is typically a colorless to pale yellow liquid with a pleasant odor, indicating its potential use in various applications, including as a solvent or in the synthesis of other chemical compounds. The presence of both ester and methyl functional groups suggests that it may exhibit moderate polarity, making it soluble in organic solvents while having limited solubility in water. Monomethyl β-methylglutarate may also participate in various chemical reactions, such as esterification and transesterification, which are common in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential health and environmental impacts.
Formula:C7H12O4
InChI:InChI=1/C7H12O4/c1-5(3-6(8)9)4-7(10)11-2/h5H,3-4H2,1-2H3,(H,8,9)
InChI key:BYBMHSADRRMVHY-UHFFFAOYSA-N
SMILES:CC(CC(=O)O)CC(=O)OC
Synonyms:
  • 5-Methoxy-3-methyl-5-oxopentanoic acid
  • Pentanedioic acid, 3-methyl-, monomethyl ester
  • Monomethyl β-methyloglutarate
Found 4 products.