CymitQuimica logo

CAS 2716-53-2

:

monoelaidin (C18:1

Description:
Monoelaidin, with the chemical formula C18:1 and CAS number 2716-53-2, is a monounsaturated fatty acid derived from the glycerol ester of oleic acid. It is characterized by a long hydrocarbon chain containing 18 carbon atoms and a single double bond, which is typically located at the ninth carbon from the methyl end of the chain. This structural feature contributes to its fluidity and lower melting point compared to saturated fatty acids. Monoelaidin is commonly found in various natural fats and oils, particularly in animal fats and some vegetable oils. It plays a significant role in biological systems, serving as a component of phospholipids in cell membranes and influencing membrane fluidity and function. Additionally, monoelaidin can be involved in metabolic processes and is of interest in food science and nutrition due to its potential health benefits associated with monounsaturated fats. Its properties make it relevant in both industrial applications and research related to lipid chemistry and nutrition.
Formula:C21H40O4
InChI:InChI=1/C21H40O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h9-10,20,22-23H,2-8,11-19H2,1H3/b10-9+
InChI key:RZRNAYUHWVFMIP-MDZDMXLPSA-N
SMILES:CCCCCCCC/C=C/CCCCCCCC(=O)OCC(CO)O
Synonyms:
  • Monoelaidin
  • 2,3-dihydroxypropyl (9E)-octadec-9-enoate
Found 6 products.