CymitQuimica logo

CAS 272-23-1

:

Thieno[2,3-b]pyridine

Description:
Thieno[2,3-b]pyridine is a heterocyclic organic compound characterized by a fused ring system that incorporates both a thiophene and a pyridine moiety. This compound features a five-membered thiophene ring containing sulfur and a six-membered pyridine ring containing nitrogen, which contributes to its unique chemical properties. Thieno[2,3-b]pyridine is typically a colorless to pale yellow solid, and it is known for its aromatic nature, which enhances its stability and reactivity. The presence of the nitrogen atom in the pyridine ring allows for potential basicity and coordination with metal ions, making it of interest in coordination chemistry and catalysis. Additionally, this compound exhibits interesting electronic properties, which can be exploited in organic electronics and materials science. Thieno[2,3-b]pyridine derivatives are often studied for their biological activity, including potential applications in pharmaceuticals, due to their ability to interact with various biological targets. Overall, this compound is significant in both synthetic and applied chemistry contexts.
Formula:C7H5NS
InChI:InChI=1/C7H5NS/c1-2-6-3-5-9-7(6)8-4-1/h1-5H
InChI key:SMZMHUCIDGHERP-UHFFFAOYSA-N
SMILES:c1cc2ccsc2nc1
Found 4 products.