CAS 272778-10-6

Silicic acid (H4SiO4),tetra(ethyl-d5) ester (9CI)

Description:

Silicic acid (H4SiO4), tetra(ethyl-d5) ester, also known by its CAS number 272778-10-6, is an organosilicon compound characterized by the presence of a silicic acid backbone modified with ethyl-d5 groups. This compound features a silicon atom bonded to four ethyl-d5 groups, which are deuterated versions of ethyl groups, meaning they contain deuterium instead of the more common hydrogen. The presence of deuterium can influence the compound's physical and chemical properties, such as its stability and reactivity. Silicic acid derivatives are often utilized in various applications, including as precursors in the synthesis of silicate materials, in coatings, and in pharmaceuticals. The tetra(ethyl-d5) ester form suggests that it may exhibit unique solubility and volatility characteristics compared to its non-deuterated counterparts. Additionally, the compound's structure may allow for specific interactions in chemical reactions, making it of interest in both industrial and research settings. As with many organosilicon compounds, safety and handling precautions should be observed due to potential reactivity and toxicity.

Formula: C₈D₂₀O₄Si

InChI: InChI=1S/C8H20O4Si/c1-5-9-13(10-6-2,11-7-3)12-8-4/h5-8H2,1-4H3/i1D3,2D3,3D3,4D3,5D2,6D2,7D2,8D2

InChI key: BOTDANWDWHJENH-DEHFLJNXSA-N

SMILES: [2H]C([2H])([2H])C([2H])([2H])O[Si](OC([2H])([2H])C([2H])([2H])[2H])(OC([2H])([2H])C([2H])([2H])[2H])OC([2H])([2H])C([2H])([2H])[2H]

Synonyms:

• Tetraethoxy-D20-Silane

Tetraethoxy-d20-silane

CAS: 272778-10-6, 78-10-4

Formula: Si(OCD₂CD₃)₄

Purity: 99 atom % D

Color and Shape: Colorless Liquid

Molecular weight: 228.23862

Ref: 3U-D3940

Tetraethoxy-d20-silane

Controlled Product

CAS: 272778-10-6

Applications Tetraethoxy-d20-silane (CAS# 272778-10-6) is a useful isotopically labeled research compound.

Formula: C₈D₁₉HO₄Si

Color and Shape: Neat

Molecular weight: 227.445

Ref: TR-T291481