CymitQuimica logo

CAS 272778-13-9

:

(3R,4S)-1-(4-Fluorophenyl)-3-((S)-3-(4-fluorophenyl-3-(trimethylsilyloxy)propyl)-4-(4-(trimethylsilyloxy)phenyl)azetidin-2-one

Description:
The chemical substance with the name "(3R,4S)-1-(4-Fluorophenyl)-3-((S)-3-(4-fluorophenyl-3-(trimethylsilyloxy)propyl)-4-(4-(trimethylsilyloxy)phenyl)azetidin-2-one" and CAS number "272778-13-9" is a complex organic compound characterized by its specific stereochemistry and functional groups. It features a fluorophenyl moiety, indicating the presence of a fluorine atom attached to a phenyl ring, which can influence its reactivity and biological activity. The compound also contains azetidinone, a four-membered lactam ring, which contributes to its structural rigidity and potential pharmacological properties. The presence of trimethylsilyloxy groups suggests that the compound may exhibit enhanced stability and solubility, making it suitable for various applications in medicinal chemistry. Its stereochemical configuration, denoted by the (3R,4S) and (S) designations, is crucial for determining its interaction with biological targets, as stereochemistry can significantly affect the efficacy and safety of pharmaceutical agents. Overall, this compound exemplifies the complexity often found in drug design, where multiple functional groups and stereochemical considerations play a vital role in its properties.
Formula:C30H37F2NO3Si2
InChI:InChI=1S/C30H37F2NO3Si2/c1-37(2,3)35-26-17-9-22(10-18-26)29-27(30(34)33(29)25-15-13-24(32)14-16-25)19-20-28(36-38(4,5)6)21-7-11-23(31)12-8-21/h7-18,27-29H,19-20H2,1-6H3/t27-,28+,29-/m1/s1
InChI key:JHMCCBLFRSWDAL-SSBOKUKZSA-N
SMILES:C[Si](C)(C)OC1=CC=C(C=C1)[C@@H]2[C@H](C(=O)N2C3=CC=C(C=C3)F)CC[C@@H](C4=CC=C(C=C4)F)O[Si](C)(C)C
Synonyms:
  • 2-Azetidinone, 1-(4-fluorophenyl)-3-[(3S)-3-(4-fluorophenyl)-3-[(trimethylsilyl)oxy]propyl]-4-[4-[(trimethylsilyl)oxy]phenyl]-, (3R,4S)-
Found 2 products.