CAS 273-13-2
:2,1,3-Benzothiadiazole
Description:
2,1,3-Benzothiadiazole, with the CAS number 273-13-2, is a heterocyclic compound characterized by a fused benzene and thiadiazole ring system. This compound typically exhibits a yellow to orange color and is known for its stability and relatively low solubility in water, while being more soluble in organic solvents. It possesses a planar structure, which contributes to its ability to participate in π-π stacking interactions, making it useful in various applications, including organic electronics and photonic devices. The presence of the thiadiazole moiety imparts unique electronic properties, allowing it to act as a building block in the synthesis of dyes, pigments, and semiconductors. Additionally, 2,1,3-benzothiadiazole derivatives have been studied for their potential biological activities, including antimicrobial and anticancer properties. Its reactivity can be attributed to the electron-deficient nature of the thiadiazole ring, making it a versatile compound in organic synthesis and materials science.
Formula:C6H4N2S
InChI:InChI=1S/C6H4N2S/c1-2-4-6-5(3-1)7-9-8-6/h1-4H
InChI key:InChIKey=PDQRQJVPEFGVRK-UHFFFAOYSA-N
SMILES:C=12C(=NSN1)C=CC=C2
Synonyms:- 2-Thia-1,3-diaza-2H-isoindene
- 3,4-Benzo-1,2,5-thiadiazole
- Benzisothiadiazole
- Benzo-2,1,3-thiadiazole
- Benzo[1,2,5]thiadiazole
- Benzo[C]-1,2,5-Thiadiazole
- NSC 43636
- NSC 679
- Piazthiole
- 2,1,3-Benzothiadiazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,1,3-Benzothiadiazole
CAS:Formula:C6H4N2SPurity:>99.0%(GC)Color and Shape:White to Light yellow powder to lumpMolecular weight:136.172,1,3-Benzothiadiazole, 98%
CAS:The product is used as an industrial solvent, and pharmaceutical intermediates for organic synthesis and used nitrocellulose and other resin, wax, fatty, dyes and other solvents. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentatioFormula:C6H4N2SPurity:98%Color and Shape:Power or solid, White to off-whiteMolecular weight:136.172,1,3-Benzothiadiazole
CAS:2,1,3-BenzothiadiazoleFormula:C6H4N2SPurity:98%Color and Shape:Solid-Low MeltMolecular weight:136.174362,1,3-Benzothiadiazole
CAS:2,1,3-Benzothiadiazole is a heterocyclic compound that is used as a chemical intermediate in the synthesis of polymers. It is also an important precursor for the synthesis of herbicides and other pesticides. In biological studies, 2,1,3-benzothiadiazole has been shown to have enzyme activities that are associated with polymerization reactions. This compound has been shown to reduce the redox potential of water solutions and induce light emission when dissolved in a reaction solution containing metal ions. 2,1,3-Benzothiadiazole binds to the nitrogen atoms on the base pair of DNA and alters its structure by steric interactions. The chemical stability of this molecule makes it suitable for use in chemical pesticides.Formula:C6H4N2SPurity:Min. 95%Color and Shape:White PowderMolecular weight:136.18 g/mol





