CAS 273-77-8
:1,2,3-Benzothiadiazole
Description:
1,2,3-Benzothiadiazole is a heterocyclic compound characterized by a fused ring system containing both nitrogen and sulfur atoms. It features a benzene ring fused to a thiadiazole ring, which consists of two nitrogen atoms and one sulfur atom. This compound is typically a yellow to orange crystalline solid and is known for its stability and relatively low solubility in water, but it is soluble in organic solvents. 1,2,3-Benzothiadiazole exhibits interesting electronic properties, making it useful in various applications, including organic electronics, dyes, and as a building block in the synthesis of more complex molecules. Its derivatives often display biological activity, which has led to research into its potential as a pharmaceutical agent. The compound's structure allows for various substitutions, which can modify its chemical reactivity and properties, making it a versatile compound in both industrial and research settings. Safety data indicates that it should be handled with care, as with many chemical substances, due to potential toxicity and environmental impact.
Formula:C6H4N2S
InChI:InChI=1S/C6H4N2S/c1-2-4-6-5(3-1)7-8-9-6/h1-4H
InChI key:InChIKey=FNQJDLTXOVEEFB-UHFFFAOYSA-N
SMILES:C1=2C(SN=N1)=CC=CC2
Synonyms:- 1,2,3-Benzothiadiazol
- 1,3-Benzothiadiazole
- Benzo-1,2,3-Thiadizole
- Benzo-1,2,3-thiadiazole
- Nsc 111919
- 1,2,3-Benzothiadiazole
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Benzo[d][1,2,3]thiadiazole
CAS:Benzo[d][1,2,3]thiadiazoleFormula:C6H4N2SPurity:98%Molecular weight:136.17Benzo[d][1,2,3]thiadiazole
CAS:Formula:C6H4N2SPurity:97%Color and Shape:SolidMolecular weight:136.1744Benzo[d][1,2,3]thiadiazole
CAS:Benzo[d][1,2,3]thiadiazoleFormula:C6H4N2SPurity:97%Molecular weight:136.17Benzo[d][1,2,3]thiadiazole
CAS:Benzo[d][1,2,3]thiadiazole is a benzothiadiazole with a redox potential of -0.25 V that is stable in the absence of oxygen and light. It can be used to synthesize chemical pesticides by reacting with hydrochloric acid. The reaction mechanism of benzo[d][1,2,3]thiadiazole has been determined using nuclear magnetic resonance spectroscopy and quantum chemical calculations. This compound reacts with hydrogen bond acceptors on the enzyme active site to form covalent bonds. It also interacts with the enzyme's steric environment by forming hydrogen bonds and van der Waals forces. Benzo[d][1,2,3]thiadiazole also emits light when it reacts with nitric oxide in solution.
Formula:C6H4N2SPurity:Min. 95%Molecular weight:136.17 g/mol




