CymitQuimica logo

CAS 273378-16-8

:

1-(tert-butoxycarbonyl)-4-cyclohexylpiperidine-4-carboxylic acid

Description:
1-(tert-Butoxycarbonyl)-4-cyclohexylpiperidine-4-carboxylic acid is a chemical compound characterized by its complex structure, which includes a piperidine ring substituted with a cyclohexyl group and a tert-butoxycarbonyl (Boc) protecting group. This compound typically appears as a solid at room temperature and is soluble in organic solvents such as dichloromethane and dimethyl sulfoxide, but may have limited solubility in water. The presence of the carboxylic acid functional group indicates that it can participate in acid-base reactions, while the Boc group serves as a protective moiety, often used in organic synthesis to prevent unwanted reactions during multi-step processes. The cyclohexyl substitution can influence the compound's steric and electronic properties, potentially affecting its reactivity and interactions with biological targets. This compound may be of interest in medicinal chemistry and drug development, particularly in the synthesis of novel pharmaceuticals. As with many organic compounds, handling should be done with care, following appropriate safety protocols.
Formula:C17H29NO4
InChI:InChI=1/C17H29NO4/c1-16(2,3)22-15(21)18-11-9-17(10-12-18,14(19)20)13-7-5-4-6-8-13/h13H,4-12H2,1-3H3,(H,19,20)
InChI key:JGHJZAWKPOYZNI-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC(CC1)(C1CCCCC1)C(=O)O
Found 1 products.