CAS 2738542-58-8

Pyrazolo[3,4-b]indole-5-carboxylic acid, 2,8-dihydro-2-methyl-8-[4-(trifluoromethyl)phenyl]-

Description:

Pyrazolo[3,4-b]indole-5-carboxylic acid, 2,8-dihydro-2-methyl-8-[4-(trifluoromethyl)phenyl]- is a complex organic compound characterized by its unique pyrazoloindole structure, which incorporates both a pyrazole and an indole moiety. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity in various chemical reactions. The presence of a trifluoromethyl group on the phenyl ring enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The dihydro and methyl substituents provide additional steric and electronic properties that can affect the compound's stability and interactions with biological targets. Overall, this compound is likely to exhibit interesting pharmacological properties, making it a candidate for further research in drug development and related fields. Its specific characteristics, such as solubility, melting point, and reactivity, would require empirical investigation to fully understand its behavior in different environments.

Formula: C₁₈H₁₂F₃N₃O₂

InChI: InChI=1S/C18H12F3N3O2/c1-23-9-14-13-8-10(17(25)26)2-7-15(13)24(16(14)22-23)12-5-3-11(4-6-12)18(19,20)21/h2-9H,1H3,(H,25,26)

InChI key: HUSMWXZHQVTDRU-UHFFFAOYSA-N

SMILES: CN1C=C2C3=C(C=CC(=C3)C(=O)O)N(C2=N1)C4=CC=C(C=C4)C(F)(F)F

Synonyms:

• MCS-4106
• MSC4106
• MSC-4106
• Pyrazolo[3,4-b]indole-5-carboxylic acid, 2,8-dihydro-2-methyl-8-[4-(trifluoromethyl)phenyl]-

MSC-4106

CAS: 2738542-58-8

MSC-4106

Formula: C₁₈H₁₂F₃N₃O₂

Purity: 99.5%

Molecular weight: 359.3

Ref: 54-BUP12604

MSC-4106

CAS: 2738542-58-8

Formula: C₁₈H₁₂F₃N₃O₂

Molecular weight: 359.302

Ref: IN-DA024G68

MSC-4106

CAS: 2738542-58-8

2-Methyl-8-(4-(trifluoromethyl)phenyl)-2,8-dihydropyrazolo[3,4-b]indole-5-carboxylic acid

Formula: C₁₈H₁₂F₃N₃O₂

Purity: 98%

Molecular weight: 359.3

Ref: IN-DG01591222

MSC-4106

CAS: 2738542-58-8

MSC-4106, an oral YAP/TAZ-TEAD inhibitor, blocks TEAD1/3 auto-palmitoylation and suppresses NCI-H226 tumors.

Formula: C₁₈H₁₂F₃N₃O₂

Purity: 99.89%

Color and Shape: Solid

Molecular weight: 359.302

Ref: TM-T60148