CAS 27387-31-1: 1,2,3,9-Tetrahydro-9-methyl-4H-carbazol-4-one
Description:1,2,3,9-Tetrahydro-9-methyl-4H-carbazol-4-one, with the CAS number 27387-31-1, is a chemical compound that belongs to the class of carbazoles, which are polycyclic aromatic compounds. This substance features a fused ring system that includes a carbazole moiety, characterized by its nitrogen-containing heterocyclic structure. The presence of the tetrahydro group indicates that it has undergone partial hydrogenation, resulting in a saturated structure that contributes to its stability and solubility properties. The methyl group at the 9-position enhances its lipophilicity, potentially influencing its biological activity and interaction with various receptors. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its physical properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Overall, 1,2,3,9-Tetrahydro-9-methyl-4H-carbazol-4-one represents a unique structure with potential applications in drug development and material science.
Formula:C13H13NO
InChI:InChI=1S/C13H13NO/c1-14-10-6-3-2-5-9(10)13-11(14)7-4-8-12(13)15/h2-3,5-6H,4,7-8H2,1H3
InChI key:InChIKey=HHJUJCWZKJMCLC-UHFFFAOYSA-N
SMILES:O=C1C=2C=3C=CC=CC3N(C2CCC1)C
- Synonyms:
- 1,2,3,9-Tetrahydro-4H-9-methyl-carbazole-4-one
- 1,2,3,9-Tetrahydro-9-methyl-4H-carbazol-4-one
- 1,2,3,9-Tetrahydro-9-methyl-4H-carbazole-4-one
- 4H-Carbazol-4-one, 1,2,3,9-tetrahydro-9-methyl-
- 9-Methyl-1,2,3,4-tetrahydro-4-oxocarbazolt
- 9-methyl-1,2,3,9-tetrahydro-4H-carbazol-4-one
- Carbazol-4(1H)-one, 2,3-dihydro-9-methyl-
