CymitQuimica logo

CAS 27389-49-7

:

3,5-dimethylbenzohydrazide

Description:
3,5-Dimethylbenzohydrazide is an organic compound characterized by its hydrazide functional group attached to a substituted benzene ring. It features two methyl groups located at the 3 and 5 positions of the benzene ring, which influence its physical and chemical properties. This compound typically appears as a crystalline solid and is soluble in organic solvents, though its solubility in water is limited. The presence of the hydrazide group imparts reactivity, making it useful in various chemical reactions, including condensation and coupling reactions. 3,5-Dimethylbenzohydrazide can serve as a precursor in the synthesis of more complex organic molecules and may exhibit biological activity, which warrants investigation in pharmaceutical applications. Its molecular structure contributes to its stability and potential interactions with other chemical species. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C9H12N2O
InChI:InChI=1/C9H12N2O/c1-6-3-7(2)5-8(4-6)9(12)11-10/h3-5H,10H2,1-2H3,(H,11,12)
InChI key:JAXXNYJSWNHITI-UHFFFAOYSA-N
SMILES:Cc1cc(C)cc(c1)C(=NN)O
Synonyms:
  • 3,5-Dimethylbenzoic acid hydrazide
  • Benzoic Acid, 3,5-Dimethyl-, Hydrazide
Found 3 products.