CymitQuimica logo

CAS 274-45-3

:

Pyrrolo[1,2-a]pyrazine

Description:
Pyrrolo[1,2-a]pyrazine is a bicyclic organic compound characterized by its fused pyrrole and pyrazine rings. It has a molecular formula that typically includes carbon and nitrogen atoms, reflecting its heterocyclic nature. This compound is known for its aromatic properties, which contribute to its stability and reactivity. Pyrrolo[1,2-a]pyrazine exhibits a range of chemical behaviors, including potential interactions with various biological systems, making it of interest in medicinal chemistry and drug development. Its structure allows for various substitution patterns, which can influence its physical and chemical properties, such as solubility and reactivity. Additionally, this compound may be involved in various synthetic pathways, serving as a building block for more complex molecules. Due to its unique structure, pyrrolo[1,2-a]pyrazine and its derivatives have been studied for their potential applications in pharmaceuticals, agrochemicals, and materials science. Overall, its distinctive characteristics make it a subject of interest in both academic and industrial research.
Formula:C7H6N2
InChI:InChI=1S/C7H6N2/c1-2-7-6-8-3-5-9(7)4-1/h1-6H
InChI key:InChIKey=QSLLFYVBWXWUQT-UHFFFAOYSA-N
SMILES:C=12N(C=CC1)C=CN=C2
Synonyms:
  • 3a,6-Diazainden
  • 7-Azaindolizine
  • Pyrrolo<1,2-a>pyrazin
  • Pyrrolo[1,2-a]pyrazine
  • Pyrrolo<1,2-a>pyrazine
Found 4 products.