CymitQuimica logo

CAS 27452-17-1

:

6-Bromo-1,1,4,4-tetramethyl-1,2,3,4-tetrahydronaphthalene

Description:
6-Bromo-1,1,4,4-tetramethyl-1,2,3,4-tetrahydronaphthalene, with the CAS number 27452-17-1, is an organic compound characterized by its complex structure, which includes a bromine substituent and multiple methyl groups attached to a tetrahydronaphthalene framework. This compound typically exhibits a hydrophobic nature due to its polycyclic structure and the presence of multiple alkyl groups, which can influence its solubility in organic solvents. The bromine atom introduces a site for potential reactivity, making it useful in various synthetic applications, including as an intermediate in organic synthesis. The presence of the bulky tetramethyl groups can also affect its steric properties, potentially influencing its reactivity and interactions with other molecules. Additionally, compounds like this may exhibit interesting physical properties, such as distinct melting and boiling points, and may be studied for their potential applications in materials science or medicinal chemistry. Overall, 6-Bromo-1,1,4,4-tetramethyl-1,2,3,4-tetrahydronaphthalene is a notable compound in organic chemistry with diverse implications in research and industry.
Formula:C14H19Br
InChI:InChI=1/C14H19Br/c1-13(2)7-8-14(3,4)12-9-10(15)5-6-11(12)13/h5-6,9H,7-8H2,1-4H3
InChI key:NLOOVMVNNNYLFS-UHFFFAOYSA-N
SMILES:CC1(C)CCC(C)(C)c2cc(ccc12)Br
Synonyms:
  • Naphthalene, 6-bromo-1,2,3,4-tetrahydro-1,1,4,4-tetramethyl-
Found 5 products.