CymitQuimica logo

CAS 27485-15-0

:

9,10-dioxo-9,10-dihydroanthracene-2,3-dicarboxylic acid

Description:
9,10-Dioxo-9,10-dihydroanthracene-2,3-dicarboxylic acid, also known by its CAS number 27485-15-0, is an organic compound characterized by its polycyclic aromatic structure. This compound features two carboxylic acid functional groups and two ketone groups, contributing to its reactivity and potential applications in organic synthesis and materials science. It is typically a solid at room temperature and may exhibit limited solubility in water, while being more soluble in organic solvents. The presence of the dioxo and dicarboxylic acid functionalities suggests that it can participate in various chemical reactions, including esterification and condensation reactions. Its structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry and as a precursor for dyes or pigments. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations for its handling and application in research and industry.
Formula:C16H8O6
InChI:InChI=1/C16H8O6/c17-13-7-3-1-2-4-8(7)14(18)10-6-12(16(21)22)11(15(19)20)5-9(10)13/h1-6H,(H,19,20)(H,21,22)
InChI key:PSHVQIKBLXBIQJ-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)C(=O)c1cc(c(cc1C2=O)C(=O)O)C(=O)O
Synonyms:
  • 2,3-Anthracenedicarboxylic Acid, 9,10-Dihydro-9,10-Dioxo-
Found 8 products.