CAS 27485-15-0
:9,10-dioxo-9,10-dihydroanthracene-2,3-dicarboxylic acid
Description:
9,10-Dioxo-9,10-dihydroanthracene-2,3-dicarboxylic acid, also known by its CAS number 27485-15-0, is an organic compound characterized by its polycyclic aromatic structure. This compound features two carboxylic acid functional groups and two ketone groups, contributing to its reactivity and potential applications in organic synthesis and materials science. It is typically a solid at room temperature and may exhibit limited solubility in water, while being more soluble in organic solvents. The presence of the dioxo and dicarboxylic acid functionalities suggests that it can participate in various chemical reactions, including esterification and condensation reactions. Its structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry and as a precursor for dyes or pigments. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations for its handling and application in research and industry.
Formula:C16H8O6
InChI:InChI=1/C16H8O6/c17-13-7-3-1-2-4-8(7)14(18)10-6-12(16(21)22)11(15(19)20)5-9(10)13/h1-6H,(H,19,20)(H,21,22)
SMILES:c1ccc2c(c1)C(=O)c1cc(c(cc1C2=O)C(=O)O)C(=O)O
Synonyms:- 2,3-Anthracenedicarboxylic Acid, 9,10-Dihydro-9,10-Dioxo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Anthraquinone-2,3-dicarboxylic Acid
CAS:Formula:C16H8O6Purity:>98.0%(T)(HPLC)Color and Shape:White to Light yellow to Green powder to crystalMolecular weight:296.232,3-Dioxo-2,3-Dihydroanthracene-1,4-Dicarboxylic Acid
CAS:2,3-Dioxo-2,3-Dihydroanthracene-1,4-Dicarboxylic AcidFormula:C16H8O6Purity:98%Molecular weight:296.232,3-Dioxo-2,3-dihydroanthracene-1,4-dicarboxylic acid
CAS:Formula:C16H8O6Purity:95%Color and Shape:SolidMolecular weight:296.23112,3-Anthraquinonedicarboxylic acid
CAS:2,3-Anthraquinonedicarboxylic acid is a molecule that can be synthesized by the dehydration of 4-tert-butylbenzoic acid in the presence of fluorine and chlorine. This compound has been shown to have antibacterial activity against gram-positive bacteria. 2,3-Anthraquinonedicarboxylic acid inhibits bacterial growth by binding to the functional groups on ribosomes and preventing protein synthesis. It also interacts with nitro groups and accepts electrons from polycarboxylic acids, which may lead to its increased antibacterial activity. The molecular structure of 2,3-anthraquinonedicarboxylic acid contains a double bond between carbons 2 and 3, which is broken down during synthesis. This reaction forms a disulfide bond.Formula:C16H8O6Purity:Min. 95%Color and Shape:Off-White PowderMolecular weight:296.23 g/mol2,3-Anthraquinonedicarboxylic Acid
CAS:Controlled ProductFormula:C16H8O6Color and Shape:NeatMolecular weight:296.231




