CAS 275-03-6
:Tetrazolo[1,5-a]pyrimidine
Description:
Tetrazolo[1,5-a]pyrimidine is a heterocyclic compound characterized by a fused ring system that incorporates both a tetrazole and a pyrimidine moiety. This compound features a five-membered tetrazole ring, which contains four nitrogen atoms and one carbon atom, fused to a six-membered pyrimidine ring that contains two nitrogen atoms and four carbon atoms. The presence of multiple nitrogen atoms contributes to its potential for forming hydrogen bonds, making it a candidate for various biological activities. Tetrazolo[1,5-a]pyrimidine is known for its applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. It exhibits properties such as moderate solubility in polar solvents and stability under standard conditions. The compound's unique structure allows for diverse functionalization, which can enhance its pharmacological properties. Overall, Tetrazolo[1,5-a]pyrimidine is a significant compound in the field of organic chemistry and drug design, with ongoing research into its potential applications.
Formula:C4H3N5
InChI:InChI=1S/C4H3N5/c1-2-5-4-6-7-8-9(4)3-1/h1-3H
InChI key:InChIKey=ZDGQAVFYXBCIKB-UHFFFAOYSA-N
SMILES:C=12N(N=NN1)C=CC=N2
Synonyms:- Tetrazolo[1,5-a]pyrimidine
- 1,2,3,3a,7-Pentaazaindene
- NSC 409071
- 1,2,3,8-Tetraazapyrrocoline
- 1,2,3,8-Tetrazaindolizine
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
