CymitQuimica logo

CAS 27542-85-4

:

2-Propenoic acid, 3-[4-(acetyloxy)phenyl]-, (E)-

Description:
2-Propenoic acid, 3-[4-(acetyloxy)phenyl]-, (E)-, commonly known as an acrylic acid derivative, is characterized by its unsaturated carboxylic acid structure, which includes a propenoic acid backbone with a phenyl group substituted at the third position. The presence of the acetyloxy group at the para position of the phenyl ring enhances its reactivity and solubility in organic solvents. This compound typically exhibits properties such as being a colorless to pale yellow liquid with a characteristic odor. It is soluble in water and various organic solvents, making it versatile for different applications. The (E)-configuration indicates the specific geometric arrangement of the substituents around the double bond, which can influence its reactivity and interaction with other molecules. This compound is often utilized in polymer chemistry, particularly in the synthesis of various polymers and copolymers, due to its ability to undergo polymerization reactions. Additionally, it may have applications in the production of coatings, adhesives, and other materials in the chemical industry.
Formula:C11H10O4
InChI:InChI=1S/C11H10O4/c1-8(12)15-10-5-2-9(3-6-10)4-7-11(13)14/h2-7H,1H3,(H,13,14)/b7-4+
InChI key:BYHBHNKBISXCEP-QPJJXVBHSA-N
SMILES:CC(=O)OC1=CC=C(C=C1)/C=C/C(=O)O
Found 3 products.