CymitQuimica logo

CAS 27563-65-1

:

3-chlorophthalic acid

Description:
3-Chlorophthalic acid is an aromatic compound characterized by the presence of a chlorinated phthalic acid structure. It features a chlorine atom substituted at the 3-position of the phthalic acid framework, which consists of two carboxylic acid groups (-COOH) attached to a benzene ring. This compound typically appears as a white to off-white crystalline solid and is sparingly soluble in water, but more soluble in organic solvents such as ethanol and acetone. The presence of the chlorine atom influences its chemical reactivity, making it useful in various applications, including the synthesis of dyes, pharmaceuticals, and agrochemicals. Additionally, 3-chlorophthalic acid can participate in various chemical reactions, such as esterification and nucleophilic substitution, due to its functional groups. Its melting point and boiling point are indicative of its stability and potential uses in industrial applications. As with many chlorinated compounds, it is essential to handle 3-chlorophthalic acid with care, considering its potential environmental and health impacts.
Formula:C8H5ClO4
InChI:InChI=1/C8H5ClO4/c9-5-3-1-2-4(7(10)11)6(5)8(12)13/h1-3H,(H,10,11)(H,12,13)
InChI key:InChIKey=BKFXSOCDAQACQM-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C(O)=O)C=CC=C1Cl
Synonyms:
  • 1,2-Benzenedicarboxylic acid, 3-chloro-
  • 3-Chloro-1,2-benzenedicarboxylic acid
  • 3-Chlorobenzene-1,2-Dicarboxylic Acid
  • NSC 62536
  • Phthalic acid, 3-chloro-
  • 3-Chlorophthalic acid
  • Einecs 248-527-7
Found 4 products.