CymitQuimica logo

CAS 27687-14-5

:

Boc-tranexamic acid

Description:
Boc-tranexamic acid, with the CAS number 27687-14-5, is a derivative of tranexamic acid, which is an antifibrinolytic agent commonly used to reduce bleeding. The "Boc" (tert-butyloxycarbonyl) group in its name indicates that it is a protected form of tranexamic acid, often utilized in peptide synthesis and other organic chemistry applications. This protective group enhances the stability of the molecule and allows for selective reactions without interfering with the active sites of the tranexamic acid structure. The compound typically exhibits characteristics such as solubility in organic solvents and limited solubility in water, which is common for many Boc-protected compounds. Its molecular structure includes an amino group, a carboxylic acid, and a cyclic structure that contributes to its biological activity. Boc-tranexamic acid is primarily used in research settings, particularly in the synthesis of peptides and other complex molecules, due to its ability to facilitate the introduction of amino acids in a controlled manner.
Formula:C13H23NO4
InChI:InChI=1S/C13H23NO4/c1-13(2,3)18-12(17)14-8-9-4-6-10(7-5-9)11(15)16/h9-10H,4-8H2,1-3H3,(H,14,17)(H,15,16)
InChI key:AZEKNJGFCSHZID-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)NCC1CCC(CC1)C(=O)O
Synonyms:
  • Boc-(4-aminomethyl)cyclohexane carboxylic acid
  • trans-4-(tert-Butoxycarbonylaminomethyl)cyclohexanecarboxylic acid
  • Trans-4-N-Boc-Aminomethyl-Cyclohexanecarboxylic Acid
Found 6 products.