CAS 277-50-9
:naphtho[1,2-b]oxirene
Description:
Naphtho[1,2-b]oxirene is a polycyclic aromatic compound characterized by its unique structure, which includes a fused naphthalene ring system and an epoxide functional group. This compound is known for its reactivity due to the presence of the epoxide, which can undergo various chemical transformations, making it a valuable intermediate in organic synthesis. Naphtho[1,2-b]oxirene is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It has a relatively low boiling point and is soluble in organic solvents, but it is less soluble in water. The compound is of interest in the fields of organic chemistry and materials science, particularly for its potential applications in the synthesis of more complex molecules. However, due to its reactive nature, handling naphtho[1,2-b]oxirene requires caution, as it may pose health risks if inhaled or absorbed through the skin. Proper safety measures should be taken when working with this substance in a laboratory setting.
Formula:C10H6O
InChI:InChI=1/C10H6O/c1-2-4-8-7(3-1)5-6-9-10(8)11-9/h1-6H
Synonyms:- Naphth(1,2-b)oxirene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
