CymitQuimica logo

CAS 27778-82-1

:

2-(2-ethoxy-5-fluorophenyl)-N,N,3-trimethylpentan-1-amine

Description:
2-(2-ethoxy-5-fluorophenyl)-N,N,3-trimethylpentan-1-amine, with the CAS number 27778-82-1, is a chemical compound that belongs to the class of amines. It features a complex structure characterized by a fluorinated aromatic ring, which contributes to its potential biological activity. The presence of the ethoxy group enhances its lipophilicity, potentially affecting its solubility and permeability in biological systems. The trimethylpentan-1-amine moiety indicates that it has a branched alkyl chain, which may influence its steric properties and interactions with biological targets. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry and drug development. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. As with many organic compounds, safety data and handling precautions are essential for laboratory work involving this substance.
Formula:C16H26FNO
InChI:InChI=1/C16H26FNO/c1-6-12(3)15(11-18(4)5)14-10-13(17)8-9-16(14)19-7-2/h8-10,12,15H,6-7,11H2,1-5H3
InChI key:STXLVWICZNDMHD-UHFFFAOYSA-N
SMILES:CCC(C)C(CN(C)C)c1cc(ccc1OCC)F
Found 1 products.