CymitQuimica logo

CAS 278-02-4

:

2H-Naphth[2,3-c]-1,2-oxazete

Description:
2H-Naphth[2,3-c]-1,2-oxazete, with the CAS number 278-02-4, is a heterocyclic organic compound characterized by its unique bicyclic structure that incorporates both naphthalene and an oxazete ring. This compound features a nitrogen and an oxygen atom within a five-membered ring, contributing to its reactivity and potential applications in organic synthesis. Typically, compounds of this nature exhibit interesting chemical properties, including the ability to undergo various reactions such as cycloadditions and rearrangements due to the strain in the oxazete ring. The presence of the naphthalene moiety may also impart additional stability and influence the compound's electronic properties. 2H-Naphth[2,3-c]-1,2-oxazete may be utilized in the development of pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. However, specific handling precautions should be observed due to potential toxicity or reactivity. As with many heterocycles, its properties can be influenced by substituents and the surrounding chemical environment, making it a subject of interest in both theoretical and applied chemistry.
Formula:C10H7NO
InChI:InChI=1S/C10H7NO/c1-2-4-8-6-10-9(11-12-10)5-7(8)3-1/h1-6,11H
InChI key:InChIKey=VHRBVWIDKIDJKW-UHFFFAOYSA-N
SMILES:C=12C(=CC=3C(C1)=CC=CC3)ON2
Synonyms:
  • 2H-Naphth[2,3-c]-1,2-oxazete
Found 1 products.