CymitQuimica logo

CAS 27825-20-3

:

methyl 3-oxo-3,4-dihydropyrazine-2-carboxylate

Description:
Methyl 3-oxo-3,4-dihydropyrazine-2-carboxylate, identified by its CAS number 27825-20-3, is a heterocyclic organic compound featuring a pyrazine ring. This compound is characterized by the presence of a carbonyl group (ketone) and a carboxylate ester functional group, which contribute to its reactivity and potential applications in organic synthesis. The dihydropyrazine structure indicates that it contains a saturated pyrazine derivative, which can participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Methyl 3-oxo-3,4-dihydropyrazine-2-carboxylate is often utilized in the synthesis of more complex molecules and may exhibit biological activity, making it of interest in medicinal chemistry. Its solubility in organic solvents and moderate stability under standard conditions are typical for compounds of this class. As with many heterocycles, the specific electronic and steric properties of this compound can influence its reactivity and interactions with other chemical species.
Formula:C6H6N2O3
InChI:InChI=1/C6H6N2O3/c1-11-6(10)4-5(9)8-3-2-7-4/h2-3H,1H3,(H,8,9)
InChI key:YVUBNSIFWJGXBQ-UHFFFAOYSA-N
SMILES:COC(=O)c1c(=O)[nH]ccn1
Synonyms:
  • 2-Pyrazinecarboxylic acid, 3-hydroxy-, methyl ester
  • Methyl 3-hydroxypyrazine-2-carboxylate
  • Methyl 2-hydroxy-3-pyrazinecarboxylate
Found 4 products.