CymitQuimica logo

CAS 27841-33-4

:

4,5-dimethoxybenzene-1,2-diamine

Description:
4,5-Dimethoxybenzene-1,2-diamine, also known as 2,3-dimethoxy-1,4-phenylenediamine, is an organic compound characterized by the presence of two methoxy groups and two amine groups attached to a benzene ring. This compound typically appears as a solid and is soluble in organic solvents due to its aromatic structure. The methoxy groups enhance its electron-donating properties, which can influence its reactivity and interaction with other chemical species. As a diamine, it can participate in various chemical reactions, including those typical of amines, such as nucleophilic substitutions and coupling reactions. Its structure allows for potential applications in the synthesis of dyes, pharmaceuticals, and polymers. Additionally, the presence of both methoxy and amino functional groups may impart unique properties, making it of interest in materials science and organic synthesis. Safety data should be consulted for handling, as with many amines, it may pose health risks if not managed properly.
Formula:C8H12N2O2
InChI:InChI=1/C8H12N2O2/c1-11-7-3-5(9)6(10)4-8(7)12-2/h3-4H,9-10H2,1-2H3
InChI key:SKIUVOVOIJBJPN-UHFFFAOYSA-N
SMILES:COc1cc(c(cc1OC)N)N
Synonyms:
  • 1,2-Benzenediamine, 4,5-dimethoxy-
  • 4,5-Dimethoxy-1,2-diaminobenzene
Found 4 products.