CymitQuimica logo

CAS 279-19-6

:

tricyclo[2.2.1.0~2,6~]heptane

Description:
Tricyclo[2.2.1.0^2,6]heptane, with the CAS number 279-19-6, is a bicyclic hydrocarbon characterized by its unique structure that consists of three interconnected cyclopropane rings. This compound is notable for its highly strained ring system, which contributes to its distinctive chemical properties. Tricycloheptane is a colorless liquid at room temperature and is relatively insoluble in water but soluble in organic solvents. Its molecular formula is C7H10, indicating it is composed of seven carbon atoms and ten hydrogen atoms. The strain in its structure leads to interesting reactivity, making it a subject of study in organic chemistry, particularly in the context of ring strain and stability. Additionally, tricycloheptane can undergo various chemical reactions, including hydrogenation and substitution, due to the presence of its strained bonds. Its unique structure and properties make it a valuable compound for research in synthetic organic chemistry and materials science.
Formula:C7H10
InChI:InChI=1/C7H10/c1-4-2-6-5(1)7(6)3-4/h4-7H,1-3H2
SMILES:C1C2CC3C1C3C2
Synonyms:
  • Tricyclo[2.2.1.0(2,6)]heptane
  • Tricyclo[2.2.1.0~2,6~]heptane
Found 1 products.