CymitQuimica logo

CAS 27914-56-3

:

Benzoic acid, 4-(2,2,2-trifluoroethoxy)-

Description:
Benzoic acid, 4-(2,2,2-trifluoroethoxy)-, is an aromatic carboxylic acid characterized by the presence of a benzoic acid moiety substituted with a 2,2,2-trifluoroethoxy group at the para position. This compound features a benzene ring, which contributes to its stability and hydrophobic characteristics, while the carboxylic acid functional group (-COOH) imparts acidic properties. The trifluoroethoxy substituent enhances the compound's lipophilicity and may influence its reactivity and solubility in organic solvents. The presence of fluorine atoms in the trifluoroethoxy group can also affect the compound's electronic properties, potentially increasing its acidity compared to non-fluorinated analogs. Benzoic acid derivatives are often utilized in various applications, including as preservatives, intermediates in organic synthesis, and in pharmaceuticals. The specific characteristics of this compound, such as its melting point, boiling point, and solubility, would depend on its molecular structure and the interactions between its functional groups.
Formula:C9H7F3O3
InChI:InChI=1S/C9H7F3O3/c10-9(11,12)5-15-7-3-1-6(2-4-7)8(13)14/h1-4H,5H2,(H,13,14)
InChI key:FXWBYMLSQLQXAR-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1C(=O)O)OCC(F)(F)F
Found 4 products.