CymitQuimica logo

CAS 279261-89-1

:

3,4-dihydro-2H-1,5-benzodioxepin-7-ylboronic acid

Description:
3,4-Dihydro-2H-1,5-benzodioxepin-7-ylboronic acid is a chemical compound characterized by its unique structural features, which include a benzodioxepin core and a boronic acid functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and interactions in various chemical environments. The presence of the boronic acid moiety allows for participation in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. Additionally, the compound may exhibit solubility in polar solvents, which is common for boronic acids, and it may engage in hydrogen bonding due to the hydroxyl group present in the boronic acid structure. Its molecular structure suggests potential applications in drug development, particularly in the design of inhibitors or modulators for biological targets. Overall, 3,4-dihydro-2H-1,5-benzodioxepin-7-ylboronic acid is a versatile compound with significant implications in synthetic and medicinal chemistry.
Formula:C9H11BO4
InChI:InChI=1/C9H11BO4/c11-10(12)7-2-3-8-9(6-7)14-5-1-4-13-8/h2-3,6,11-12H,1,4-5H2
InChI key:CSNCBPVLUIFJOS-UHFFFAOYSA-N
SMILES:C1COc2ccc(cc2OC1)B(O)O
Synonyms:
  • Boronic acid,B-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-
Found 4 products.