CAS 27943-07-3

5-cyclopropyl-2H-tetrazole

Description:

5-Cyclopropyl-2H-tetrazole is a heterocyclic compound characterized by its tetrazole ring, which consists of four nitrogen atoms and one carbon atom, contributing to its unique chemical properties. The presence of the cyclopropyl group enhances its reactivity and influences its physical properties, such as solubility and boiling point. This compound is typically a white to off-white solid and is known for its potential applications in medicinal chemistry, particularly as a building block in the synthesis of pharmaceuticals. The tetrazole moiety is often associated with biological activity, including antimicrobial and anti-inflammatory properties. Additionally, 5-cyclopropyl-2H-tetrazole may exhibit interesting coordination chemistry due to the presence of nitrogen atoms, which can act as ligands in metal complexes. Its stability and reactivity can vary depending on the conditions, making it a subject of interest in both organic synthesis and materials science. Overall, 5-cyclopropyl-2H-tetrazole is a versatile compound with significant implications in various fields of research.

Formula: C₄H₆N₄

InChI: InChI=1/C4H6N4/c1-2-3(1)4-5-7-8-6-4/h3H,1-2H2,(H,5,6,7,8)

SMILES: C1CC1c1n[nH]nn1

Synonyms:

• 2H-Tetrazole, 5-cyclopropyl-
• 5-cyclopropyl-1H-tetrazole
• 5-cyclopropyl-2H-tetraazole
• 5-Cyclopropyl-2H-tetrazole

5-CYCLOPROPYL-2H-1,2,3,4-TETRAAZOLE

CAS: 27943-07-3

Formula: C₄H₆N₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 110.1172

Ref: IN-DA00BD0L

5-Cyclopropyl-2 H -tetrazole

CAS: 27943-07-3

Formula: C₄H₆N₄

Purity: 98.0%

Color and Shape: Solid

Molecular weight: 110.12

Ref: 10-F031643

5-Cyclopropyl-2H-tetrazole

CAS: 27943-07-3

5-Cyclopropyl-2H-tetrazole is a high quality, reagent grade chemical that is also a useful intermediate and building block. It has CAS No. 27943-07-3, and the molecular formula C5H6N4. 5-Cyclopropyl-2H-tetrazole has been used as a versatile building block for many reactions, such as those with amines and alcohols to produce amides and esters respectively. This compound can be used in the production of fine chemicals, research chemicals, and speciality chemicals.

Formula: C₄H₆N₄

Purity: Min. 95%

Color and Shape: White To Off-White Solid

Molecular weight: 110.12 g/mol

Ref: 3D-FC74676

5-cyclopropyl-1H-1,2,3,4-tetrazole

CAS: 27943-07-3

Purity: 97%

Molecular weight: 110.1200027

Ref: 10-F797189