CAS 27943-07-3
:5-cyclopropyl-2H-tetrazole
Description:
5-Cyclopropyl-2H-tetrazole is a heterocyclic compound characterized by its tetrazole ring, which consists of four nitrogen atoms and one carbon atom, contributing to its unique chemical properties. The presence of the cyclopropyl group enhances its reactivity and influences its physical properties, such as solubility and boiling point. This compound is typically a white to off-white solid and is known for its potential applications in medicinal chemistry, particularly as a building block in the synthesis of pharmaceuticals. The tetrazole moiety is often associated with biological activity, including antimicrobial and anti-inflammatory properties. Additionally, 5-cyclopropyl-2H-tetrazole may exhibit interesting coordination chemistry due to the presence of nitrogen atoms, which can act as ligands in metal complexes. Its stability and reactivity can vary depending on the conditions, making it a subject of interest in both organic synthesis and materials science. Overall, 5-cyclopropyl-2H-tetrazole is a versatile compound with significant implications in various fields of research.
Formula:C4H6N4
InChI:InChI=1/C4H6N4/c1-2-3(1)4-5-7-8-6-4/h3H,1-2H2,(H,5,6,7,8)
SMILES:C1CC1c1n[nH]nn1
Synonyms:- 2H-Tetrazole, 5-cyclopropyl-
- 5-cyclopropyl-1H-tetrazole
- 5-cyclopropyl-2H-tetraazole
- 5-Cyclopropyl-2H-tetrazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Cyclopropyl-2H-tetrazole
CAS:5-Cyclopropyl-2H-tetrazoleFormula:C4H6N4Purity:97%Molecular weight:110.125-CYCLOPROPYL-2H-1,2,3,4-TETRAAZOLE
CAS:Formula:C4H6N4Purity:97%Color and Shape:SolidMolecular weight:110.11725-Cyclopropyl-2 H -tetrazole
CAS:Formula:C4H6N4Purity:98.0%Color and Shape:SolidMolecular weight:110.125-Cyclopropyl-2H-tetrazole
CAS:5-Cyclopropyl-2H-tetrazole is a high quality, reagent grade chemical that is also a useful intermediate and building block. It has CAS No. 27943-07-3, and the molecular formula C5H6N4. 5-Cyclopropyl-2H-tetrazole has been used as a versatile building block for many reactions, such as those with amines and alcohols to produce amides and esters respectively. This compound can be used in the production of fine chemicals, research chemicals, and speciality chemicals.Formula:C4H6N4Purity:Min. 95%Color and Shape:White To Off-White SolidMolecular weight:110.12 g/mol




