CAS 2797066-85-2

4-[(2S,4S)-4-(Cyclopropylmethoxy)-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-2-piperidinyl]benzoic acid

Description:

The chemical substance known as 4-[(2S,4S)-4-(Cyclopropylmethoxy)-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-2-piperidinyl]benzoic acid, with the CAS number 2797066-85-2, is a complex organic compound characterized by its multi-functional structure. It features a benzoic acid moiety, which contributes to its acidic properties, and a piperidine ring that may influence its biological activity and solubility. The presence of a cyclopropylmethoxy group and an indole derivative suggests potential interactions with biological targets, possibly indicating pharmacological relevance. The stereochemistry indicated by the (2S,4S) configuration suggests specific spatial arrangements that can affect the compound's reactivity and interactions. This compound may exhibit unique properties such as solubility in organic solvents, potential for hydrogen bonding due to the presence of functional groups, and specific binding affinities in biological systems. Overall, its structural complexity hints at potential applications in medicinal chemistry, particularly in the development of therapeutic agents.

Formula: C₂₇H₃₂N₂O₄

InChI: InChI=1S/C27H32N2O4/c1-17-13-25(32-2)23(22-9-11-28-26(17)22)15-29-12-10-21(33-16-18-3-4-18)14-24(29)19-5-7-20(8-6-19)27(30)31/h5-9,11,13,18,21,24,28H,3-4,10,12,14-16H2,1-2H3,(H,30,31)/t21-,24-/m0/s1

InChI key: YJJUEZFALZMWAP-URXFXBBRSA-N

SMILES: CC1=CC(=C(C2=C1NC=C2)CN3CC[C@@H](C[C@H]3C4=CC=C(C=C4)C(=O)O)OCC5CC5)OC

Synonyms:

• 4-[(2S,4S)-4-(Cyclopropylmethoxy)-1-[(5-methoxy-7-methyl-1H-indol-4-yl)methyl]-2-piperidinyl]benzoic acid

Factor B-IN-5

CAS: 2797066-85-2

Factor B-IN-5

Formula: C₂₇H₃₂N₂O₄

Purity: 99.5%

Molecular weight: 448.55

Ref: 54-BUP17417

Factor B-IN-5

CAS: 2797066-85-2

Factor B-IN-5 is a complement factor B inhibitor, which can be used to study immune-related diseases.

Formula: C₂₇H₃₂N₂O₄

Purity: 99.71%

Color and Shape: White Solid

Molecular weight: 448.55

Ref: TM-T62689L