CymitQuimica logo

CAS 2799-58-8

:

bis(2-chloroethyl) methylphosphonate

Description:
Bis(2-chloroethyl) methylphosphonate, with the CAS number 2799-58-8, is an organophosphorus compound characterized by its phosphonate structure, which includes two 2-chloroethyl groups and a methyl group attached to a phosphorus atom. This compound is typically a colorless to pale yellow liquid with a faint odor. It is soluble in organic solvents but has limited solubility in water. The presence of chlorine atoms contributes to its reactivity, making it a potential alkylating agent. Bis(2-chloroethyl) methylphosphonate is primarily known for its applications in chemical synthesis and as an intermediate in the production of various phosphonate derivatives. It is also studied for its potential use in the development of chemical agents. Due to its chemical properties, it can pose health and environmental risks, necessitating careful handling and storage. Safety measures should be observed to mitigate exposure, as it may exhibit toxicity similar to other organophosphorus compounds.
Formula:C5H11Cl2O3P
InChI:InChI=1/C5H11Cl2O3P/c1-11(8,9-4-2-6)10-5-3-7/h2-5H2,1H3
InChI key:IPTIBLAAEZFRHZ-UHFFFAOYSA-N
SMILES:CP(=O)(OCCCl)OCCCl
Found 1 products.