CAS 280121-24-6
:5-methyl-6-(trifluoromethyl)indoline hydrochloride
Description:
5-Methyl-6-(trifluoromethyl)indoline hydrochloride is a chemical compound characterized by its indoline structure, which consists of a fused benzene and pyrrole ring. The presence of a methyl group at the 5-position and a trifluoromethyl group at the 6-position contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals and organic synthesis. The trifluoromethyl group is known for imparting distinct electronic properties, which can influence the compound's reactivity and interaction with biological targets. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or reactivity.
Formula:C10H11ClF3N
InChI:InChI=1/C10H10F3N.ClH/c1-6-4-7-2-3-14-9(7)5-8(6)10(11,12)13;/h4-5,14H,2-3H2,1H3;1H
InChI key:YGIQTJJCLKQMAR-UHFFFAOYSA-N
SMILES:CC1=CC2=C(C=C1C(F)(F)F)NCC2.Cl
Synonyms:- 5-methyl-6-(trifluoromethyl)indoline hydrochloride (1:1)
- 5-Methyl-6-(trifluormethyl)indolinhydrochlorid(1:1)
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
