CAS 280585-34-4

(2E,4E)-5-(7-methoxy-3,3-dimethyl-2,3-dihydro-1-benzoxepin-5-yl)-3-methylpenta-2,4-dienoic acid

Description:

The chemical substance known as (2E,4E)-5-(7-methoxy-3,3-dimethyl-2,3-dihydro-1-benzoxepin-5-yl)-3-methylpenta-2,4-dienoic acid, with the CAS number 280585-34-4, is a complex organic compound characterized by its unique structural features. It contains a conjugated diene system, which contributes to its potential reactivity and biological activity. The presence of a benzoxepin moiety suggests that it may exhibit interesting pharmacological properties, as benzoxepins are known for their diverse biological activities. The methoxy and dimethyl groups enhance its lipophilicity, potentially influencing its solubility and permeability in biological systems. Additionally, the compound's configuration, indicated by the (2E,4E) notation, suggests specific geometric isomerism that can affect its interaction with biological targets. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly in the context of exploring new therapeutic agents. Further studies would be necessary to elucidate its specific properties and potential applications.

Formula: C₁₉H₂₂O₄

InChI: InChI=1/C19H22O4/c1-13(9-18(20)21)5-6-14-11-19(2,3)12-23-17-8-7-15(22-4)10-16(14)17/h5-11H,12H2,1-4H3,(H,20,21)/b6-5+,13-9+

InChI key: FVGXANXBVWECQE-BYWGDBCOSA-N

SMILES: C/C(=C\C(=O)O)/C=C/C1=CC(COC2=C1C=C(C=C2)OC)(C)C

Oxeglitazar

CAS: 280585-34-4

Oxeglitazar, a peroxisome proliferator-activated receptor (PPAR) agonist, is used potentially for the treatment of gout and type two diabetes.

Formula: C₁₉H₂₂O₄

Color and Shape: Solid

Molecular weight: 314.38

Ref: TM-T28279