CymitQuimica logo

CAS 2807440-30-6

:

4-Bromo-2,6-difluoro-3-methoxybenzoic acid

Description:
4-Bromo-2,6-difluoro-3-methoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of a bromine atom, two fluorine atoms, and a methoxy group attached to a benzoic acid framework. This compound features a benzene ring substituted at the 4-position with a bromine atom, at the 2 and 6-positions with fluorine atoms, and at the 3-position with a methoxy group (-OCH3). The presence of these electronegative substituents influences its chemical reactivity, solubility, and potential applications in pharmaceuticals or agrochemicals. The carboxylic acid functional group (-COOH) contributes to its acidity and ability to form hydrogen bonds, which can enhance its solubility in polar solvents. Additionally, the unique combination of halogen and methoxy substituents may impart specific biological activities or properties, making it of interest for further research in medicinal chemistry. Overall, this compound exemplifies the complexity and diversity of substituted benzoic acids in organic chemistry.
Formula:C8H5BrF2O3
InChI:InChI=1S/C8H5BrF2O3/c1-14-7-3(9)2-4(10)5(6(7)11)8(12)13/h2H,1H3,(H,12,13)
InChI key:OHILSYDGMOUCFE-UHFFFAOYSA-N
SMILES:COC1=C(C=C(C(=C1F)C(=O)O)F)Br
Synonyms:
  • 4-Bromo-2,6-difluoro-3-methoxybenzoic acid
Found 2 products.