CymitQuimica logo

CAS 280752-68-3

:

7-bromo-1-methyl-1H-indole

Description:
7-Bromo-1-methyl-1H-indole is a chemical compound that belongs to the indole family, characterized by a bicyclic structure consisting of a benzene ring fused to a pyrrole ring. The presence of a bromine atom at the 7-position and a methyl group at the 1-position distinguishes this compound from other indoles. It typically appears as a solid or crystalline substance and is known for its potential applications in medicinal chemistry and organic synthesis. The bromine substituent can enhance the compound's reactivity, making it useful in various chemical reactions, including electrophilic substitutions and coupling reactions. Additionally, the indole structure is often associated with biological activity, which may include antimicrobial or anticancer properties. The compound's solubility, stability, and reactivity can vary depending on the solvent and conditions used. As with many brominated compounds, safety precautions should be taken due to potential toxicity and environmental concerns. Overall, 7-bromo-1-methyl-1H-indole is a versatile compound with significant implications in research and development.
Formula:C9H8BrN
InChI:InChI=1/C9H8BrN/c1-11-6-5-7-3-2-4-8(10)9(7)11/h2-6H,1H3
InChI key:CALOMHQMSHLUJX-UHFFFAOYSA-N
SMILES:Cn1ccc2cccc(c12)Br
Found 5 products.