CymitQuimica logo

CAS 28081-14-3

:

(2E)-3-(3,4-dimethoxyphenyl)-1-(4-fluorophenyl)prop-2-en-1-one

Description:
The chemical substance known as (2E)-3-(3,4-dimethoxyphenyl)-1-(4-fluorophenyl)prop-2-en-1-one, with the CAS number 28081-14-3, is an organic compound characterized by its conjugated enone structure, which features a prop-2-en-1-one backbone. This compound contains a 3,4-dimethoxyphenyl group and a 4-fluorophenyl substituent, contributing to its potential biological activity and chemical reactivity. The presence of methoxy groups enhances its lipophilicity and may influence its interaction with biological targets. The fluorine atom in the para position of the phenyl ring can affect the electronic properties and stability of the compound. Typically, such compounds are studied for their potential applications in pharmaceuticals, particularly in the development of anti-cancer agents or other therapeutic agents due to their ability to interact with various biological pathways. The compound's physical properties, such as solubility and melting point, would depend on its molecular structure and substituents, influencing its behavior in different chemical environments.
Formula:C17H15FO3
InChI:InChI=1/C17H15FO3/c1-20-16-10-4-12(11-17(16)21-2)3-9-15(19)13-5-7-14(18)8-6-13/h3-11H,1-2H3/b9-3+
Found 2 products.