CymitQuimica logo

CAS 28082-86-2

:

3,6,7-trimethylquinoxalin-2(1H)-one

Description:
3,6,7-Trimethylquinoxalin-2(1H)-one is a heterocyclic organic compound characterized by its quinoxaline structure, which consists of a fused bicyclic system containing two nitrogen atoms. This compound features three methyl groups located at the 3, 6, and 7 positions of the quinoxaline ring, contributing to its unique chemical properties and potential biological activity. The presence of the carbonyl group at the 2-position enhances its reactivity and solubility in various organic solvents. Typically, compounds of this class exhibit interesting pharmacological properties, including antimicrobial and anti-inflammatory activities, making them of interest in medicinal chemistry. The molecular formula reflects its composition, and its molecular weight is indicative of its size and complexity. Additionally, 3,6,7-trimethylquinoxalin-2(1H)-one may participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, due to the electron-rich nature of the methyl groups and the electron-deficient carbonyl. Overall, this compound represents a significant area of study for researchers exploring novel therapeutic agents.
Formula:C11H12N2O
InChI:InChI=1/C11H12N2O/c1-6-4-9-10(5-7(6)2)13-11(14)8(3)12-9/h4-5H,1-3H3,(H,13,14)
InChI key:RYSAKTAGNQULLG-UHFFFAOYSA-N
SMILES:Cc1cc2c(cc1C)[nH]c(=O)c(C)n2
Found 3 products.