CymitQuimica logo

CAS 2810876-98-1

:

1-(7-Bromo-1-methyl-1H-indazol-3-yl)dihydro-2,4(1H,3H)-pyrimidinedione

Description:
1-(7-Bromo-1-methyl-1H-indazol-3-yl)dihydro-2,4(1H,3H)-pyrimidinedione is a chemical compound characterized by its complex structure, which includes an indazole moiety and a pyrimidinedione framework. The presence of a bromine atom at the 7-position of the indazole ring contributes to its unique reactivity and potential biological activity. This compound is likely to exhibit properties typical of both indazole derivatives and pyrimidinediones, such as potential pharmacological effects, including anti-inflammatory or anticancer activities. Its molecular structure suggests it may engage in hydrogen bonding and π-π stacking interactions, which are important for its solubility and interaction with biological targets. The dihydropyrimidinedione component may also impart stability and influence the compound's overall polarity. As with many synthetic organic compounds, its synthesis and characterization would involve techniques such as NMR spectroscopy, mass spectrometry, and possibly X-ray crystallography to confirm its structure and purity. Further studies would be necessary to fully elucidate its chemical behavior and potential applications in medicinal chemistry.
Formula:C12H11BrN4O2
InChI:InChI=1S/C12H11BrN4O2/c1-16-10-7(3-2-4-8(10)13)11(15-16)17-6-5-9(18)14-12(17)19/h2-4H,5-6H2,1H3,(H,14,18,19)
InChI key:RWGBUVCQWTVODX-UHFFFAOYSA-N
SMILES:CN1C2=C(C=CC=C2Br)C(=N1)N3CCC(=O)NC3=O
Synonyms:
  • 1-(7-Bromo-1-methyl-1H-indazol-3-yl)dihydropyrimidine-2,4(1H,3H)-dione
Found 4 products.