CAS 28177-69-7
:2′-Hydroxy-3′-nitroacetophenone
Description:
2′-Hydroxy-3′-nitroacetophenone, with the CAS number 28177-69-7, is an organic compound characterized by the presence of both hydroxyl and nitro functional groups attached to an acetophenone structure. This compound typically appears as a solid and is known for its yellow to orange coloration, which is attributed to the nitro group. It exhibits moderate solubility in organic solvents, such as ethanol and acetone, but is less soluble in water due to its hydrophobic acetophenone backbone. The hydroxyl group contributes to its potential as a phenolic compound, while the nitro group can influence its reactivity and stability. This compound may be utilized in various applications, including as an intermediate in organic synthesis and in the development of dyes or pharmaceuticals. Its chemical properties, such as melting point and boiling point, can vary based on purity and environmental conditions. As with many nitro compounds, it may pose certain hazards, necessitating careful handling and storage.
Formula:C8H7NO4
InChI:InChI=1S/C8H7NO4/c1-5(10)6-3-2-4-7(8(6)11)9(12)13/h2-4,11H,1H3
InChI key:InChIKey=XQZGSPSZLMKODN-UHFFFAOYSA-N
SMILES:C(C)(=O)C1=C(O)C(N(=O)=O)=CC=C1
Synonyms:- 1-(2-Hydroxy-3-nitro-phenyl)-ethanone
- 1-(2-Hydroxy-3-nitrophenyl)ethan-1-one
- 2-Acetyl-6-nitrophenol
- 2-Hydroxy-3-nitroacetophenone
- 3′-Nitro-2′-hydroxyacetophenone
- Acetophenone, 2′-hydroxy-3′-nitro-
- Ethanone, 1-(2-hydroxy-3-nitrophenyl)-
- NSC 111935
- 1-(2-Hydroxy-3-nitrophenyl)ethanone
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1-(2-Hydroxy-3-nitrophenyl)ethan-1-one
CAS:1-(2-Hydroxy-3-nitrophenyl)ethan-1-oneFormula:C8H7NO4Purity:98%Molecular weight:181.1471-(2-Hydroxy-3-nitrophenyl)ethanone
CAS:Formula:C8H7NO4Purity:97%Color and Shape:SolidMolecular weight:181.14551-(2-Hydroxy-3-nitrophenyl)ethanone
CAS:1-(2-Hydroxy-3-nitrophenyl)ethanoneFormula:C8H7NO4Purity:98%Molecular weight:181.152-Hydroxy-3-nitroacetophenone
CAS:Formula:C8H7NO4Purity:97%Color and Shape:SolidMolecular weight:181.1472-Hydroxy-3-nitroacetophenone
CAS:2-Hydroxy-3-nitroacetophenone is an inorganic compound that belongs to the group of metal salts. It is a synthetic, directional, and oriented molecule with four stereogenic centers. 2-Hydoxy-3-nitroacetophenone can be synthesized by the reaction of azide with chromene and cyanoformate. The product has been used in the synthesis of other compounds, such as phosphorus oxychloride, nitrohydroxyacetophenone, hydrogenation reaction, and inorganic bases. The product has also shown cytotoxic activity against cancer cells. This may be due to its ability to inhibit DNA synthesis or cell division by binding to the enzyme topoisomerase II. It can also bind to nucleic acids and react with oxygen radicals in a manner similar to O2-.Formula:C8H7NO4Purity:Min. 95%Color and Shape:PowderMolecular weight:181.15 g/mol




