CAS 28197-66-2
:N-[3-Acetyl-4-(2-oxiranylmethoxy)phenyl]butanamide
Description:
N-[3-Acetyl-4-(2-oxiranylmethoxy)phenyl]butanamide, with the CAS number 28197-66-2, is a synthetic organic compound characterized by its complex molecular structure. It features an amide functional group, which is indicative of its potential as a bioactive molecule. The presence of an acetyl group suggests that it may exhibit reactivity typical of carbonyl compounds, while the oxirane (epoxide) moiety indicates potential for ring-opening reactions, making it a candidate for various chemical transformations. The phenyl ring contributes to its aromatic properties, which can influence solubility and stability. This compound may be of interest in medicinal chemistry due to its structural features that could interact with biological targets. Its synthesis and application could be relevant in the development of pharmaceuticals or agrochemicals. However, specific biological activity, toxicity, and environmental impact would require further investigation through empirical studies. Overall, this compound exemplifies the diversity of organic chemistry and the potential for novel applications in various fields.
Formula:C15H19NO4
InChI:InChI=1S/C15H19NO4/c1-3-4-15(18)16-11-5-6-14(13(7-11)10(2)17)20-9-12-8-19-12/h5-7,12H,3-4,8-9H2,1-2H3,(H,16,18)
InChI key:InChIKey=MFGKLROXINRXIU-UHFFFAOYSA-N
SMILES:O(CC1CO1)C2=C(C(C)=O)C=C(NC(CCC)=O)C=C2
Synonyms:- Butanamide, N-[3-acetyl-4-(2-oxiranylmethoxy)phenyl]-
- N-[3-Acetyl-4-(2-oxiranylmethoxy)phenyl]butanamide
- N-(3-Acetyl-4-(oxiranylmethoxy)phenyl)butyramide
- Butanamide, N-[3-acetyl-4-(oxiranylmethoxy)phenyl]-
- Butyranilide, 3′-acetyl-4′-(2,3-epoxypropoxy)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Acebutolol EP Impurity A
CAS:Formula:C15H19NO4Color and Shape:White To Off-White SolidMolecular weight:277.323’-Acetyl-4’-(2,3-epoxypropoxy)butyranilide
CAS:Impurity Acebutolol EP Impurity A
Applications 3’-Acetyl-4’-(2,3-epoxypropoxy)butyranilide (Acebutolol EP Impurity A) is a useful intermediate in the preparation of Acebutolol.
References Andresen, B., et al.: Drug Metab. Disposition, 7, 360 (1979),Formula:C15H19NO4Color and Shape:NeatMolecular weight:277.323'-Acetyl-4'-(2,3-epoxypropoxy)butyranilide
CAS:3'-Acetyl-4'-(2,3-epoxypropoxy)butyranilide is an impurity found in the drug product of 3'-acetyl-4'-(2,3-epoxypropoxy)butyranilide hydrochloride. It has a molecular weight of 268.9 and chemical formula C12H18O6N2. 3'-Acetyl-4'-(2,3-epoxypropoxy)butyranilide is a synthetic compound that can be used as an analytical reference material for HPLC standardization or as an impurity standard for synthesis.
Formula:C15H19NO4Purity:Min. 95%Molecular weight:277.32 g/mol




