CymitQuimica logo

CAS 2825012-62-0

:

1-(trifluoromethyl)-2-oxabicyclo[2.2.2]octane-4-carboxylic acid

Description:
1-(Trifluoromethyl)-2-oxabicyclo[2.2.2]octane-4-carboxylic acid is a bicyclic compound characterized by its unique structural features, including a trifluoromethyl group and a carboxylic acid functional group. The bicyclic structure consists of a fused ring system that contributes to its rigidity and potential for specific interactions in chemical reactions. The presence of the trifluoromethyl group enhances the compound's lipophilicity and can influence its reactivity and biological activity, making it of interest in medicinal chemistry and material science. The oxabicyclo framework introduces an oxygen atom into the bicyclic system, which can affect the compound's polarity and solubility. As a carboxylic acid, it exhibits acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. Overall, this compound's distinctive features make it a subject of interest for further research in synthetic applications and potential therapeutic uses.
Formula:C9H11F3O3
InChI:InChI=1S/C9H11F3O3/c10-9(11,12)8-3-1-7(2-4-8,5-15-8)6(13)14/h1-5H2,(H,13,14)
InChI key:GAXGQMVDGWIRNL-UHFFFAOYSA-N
SMILES:C1CC2(CCC1(CO2)C(=O)O)C(F)(F)F
Synonyms:
  • 1-(trifluoromethyl)-2-oxabicyclo[2.2.2]octane-4-carboxylic acid
Found 3 products.