CymitQuimica logo

CAS 2826-91-7

:

2-methyl-3-(2-nitroethenyl)-1H-indole

Description:
2-Methyl-3-(2-nitroethenyl)-1H-indole, with the CAS number 2826-91-7, is an organic compound that belongs to the indole family, characterized by a bicyclic structure containing a fused benzene and pyrrole ring. This compound features a methyl group at the 2-position and a nitroethenyl group at the 3-position of the indole ring, which contributes to its unique reactivity and properties. Typically, compounds of this nature exhibit interesting biological activities, making them of interest in medicinal chemistry and drug development. The presence of the nitro group can enhance the compound's electrophilicity, potentially leading to various chemical reactions. Additionally, the indole structure is known for its role in various natural products and pharmaceuticals, often exhibiting properties such as anti-inflammatory, antimicrobial, and anticancer activities. The compound's solubility, stability, and reactivity can vary based on the functional groups present and the overall molecular structure, making it a subject of study in both synthetic and applied chemistry contexts.
Formula:C11H10N2O2
InChI:InChI=1/C11H10N2O2/c1-8-9(6-7-13(14)15)10-4-2-3-5-11(10)12-8/h2-7,12H,1H3
InChI key:DTSVTKXSWKXFDC-VOTSOKGWSA-N
SMILES:Cc1c(C=CN(=O)=O)c2ccccc2[nH]1
Synonyms:
  • 2-methyl-3-(2-nitroethenyl)-1H-Indole
  • (E)-2-methyl-3-(2-nitrovinyl)-1H-indole
  • 2-methyl-3-(2-nitrovinyl)-1H-indole
  • See more synonyms
Found 3 products.