CymitQuimica logo

CAS 28279-52-9

:

5-Bromo-3H-imidazo[4,5-b]pyridine

Description:
5-Bromo-3H-imidazo[4,5-b]pyridine is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. The presence of a bromine atom at the 5-position enhances its reactivity and potential for substitution reactions. This compound typically exhibits a pale yellow to brown solid appearance and is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and dimethylformamide (DMF). It is often utilized in medicinal chemistry and drug development due to its biological activity, particularly in the context of targeting specific enzymes or receptors. The compound's structure allows for various functionalization, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, its stability under standard laboratory conditions makes it suitable for various applications in research and development. Safety precautions should be observed when handling this compound, as with many brominated organic substances, due to potential toxicity and environmental concerns.
Formula:C6H4BrN3
InChI:InChI=1S/C6H4BrN3/c7-5-2-1-4-6(10-5)9-3-8-4/h1-3H,(H,8,9,10)
InChI key:InChIKey=INKJIWXVLWIENL-UHFFFAOYSA-N
SMILES:BrC=1N=C2C(=CC1)NC=N2
Synonyms:
  • 1H-imidazo[4,5-b]pyridine, 5-bromo-
  • 3H-Imidazo[4,5-b]pyridine, 5-bromo-
  • 5-Bromo-4-azabenzimidazole
  • 5-bromo-3H-imidazo[4,5-b]pyridine
  • 5-Bromo-1H-imidazo[4,5-b]pyridine
Found 3 products.